C18H31N — CID 115483394
5-(3,4-diethylphenyl)-N,3,3-trimethylpentan-1-amine (PubChem CID 115483394) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 5-(3,4-diethylphenyl)-N,3,3-trimethylpentan-1-amine.
| Compound Name | 5-(3,4-diethylphenyl)-N,3,3-trimethylpentan-1-amine |
|---|---|
| PubChem CID | 115483394 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 5-(3,4-diethylphenyl)-N,3,3-trimethylpentan-1-amine |
| SMILES | CCc1ccc(CCC(C)(C)CCNC)cc1CC |
| InChI | InChI=1S/C18H31N/c1-6-16-9-8-15(14-17(16)7-2)10-11-18(3,4)12-13-19-5/h8-9,14,19H,6-7,10-13H2,1-5H3 |
| InChIKey | JUTBYMSIQYOXQA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |