C17H20 — CID 139691839
1-benzyl-2,4-diethylbenzene (PubChem CID 139691839) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-benzyl-2,4-diethylbenzene.
| Compound Name | 1-benzyl-2,4-diethylbenzene |
|---|---|
| PubChem CID | 139691839 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-benzyl-2,4-diethylbenzene |
| SMILES | CCc1ccc(Cc2ccccc2)c(CC)c1 |
| InChI | InChI=1S/C17H20/c1-3-14-10-11-17(16(4-2)12-14)13-15-8-6-5-7-9-15/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | SHNRMDKBPTYGGC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |