C21H30 — CID 160595635
1,2,4-triethylbenzene;1,2,3-trimethylbenzene (PubChem CID 160595635) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1,2,4-triethylbenzene;1,2,3-trimethylbenzene.
| Compound Name | 1,2,4-triethylbenzene;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 160595635 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1,2,4-triethylbenzene;1,2,3-trimethylbenzene |
| SMILES | CCc1ccc(CC)c(CC)c1.Cc1cccc(C)c1C |
| InChI | InChI=1S/C12H18.C9H12/c1-4-10-7-8-11(5-2)12(6-3)9-10;1-7-5-4-6-8(2)9(7)3/h7-9H,4-6H2,1-3H3;4-6H,1-3H3 |
| InChIKey | RDPATQSAGRCJLB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |