C21H42 — CID 143147503
acetylene;1,4-diethyl-2-methylbenzene;ethane (PubChem CID 143147503) has the molecular formula C21H42 and a molecular weight of 294.57 g/mol. Its IUPAC name is acetylene;1,4-diethyl-2-methylbenzene;ethane.
| Compound Name | acetylene;1,4-diethyl-2-methylbenzene;ethane |
|---|---|
| PubChem CID | 143147503 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | acetylene;1,4-diethyl-2-methylbenzene;ethane |
| SMILES | C#C.CC.CC.CC.CC.CCc1ccc(CC)c(C)c1 |
| InChI | InChI=1S/C11H16.4C2H6.C2H2/c1-4-10-6-7-11(5-2)9(3)8-10;5*1-2/h6-8H,4-5H2,1-3H3;4*1-2H3;1-2H |
| InChIKey | KLBWCERDWXLXPH-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|