About ethane;4-ethyl-3-methylbenzoic acid
ethane;4-ethyl-3-methylbenzoic acid (PubChem CID 144686494) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is ethane;4-ethyl-3-methylbenzoic acid.
Molecular Properties
| Compound Name | ethane;4-ethyl-3-methylbenzoic acid |
| PubChem CID | 144686494 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | ethane;4-ethyl-3-methylbenzoic acid |
| SMILES | CC.CC.CC.CCc1ccc(C(=O)O)cc1C |
| InChI | InChI=1S/C10H12O2.3C2H6/c1-3-8-4-5-9(10(11)12)6-7(8)2;3*1-2/h4-6H,3H2,1-2H3,(H,11,12);3*1-2H3 |
| InChIKey | MKUINZBPLZIIDL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-ethyl-3-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-3-methylbenzoic acid?
The IUPAC name of ethane;4-ethyl-3-methylbenzoic acid (CID 144686494) is ethane;4-ethyl-3-methylbenzoic acid.
What is the SMILES notation for ethane;4-ethyl-3-methylbenzoic acid?
The canonical SMILES for ethane;4-ethyl-3-methylbenzoic acid is CC.CC.CC.CCc1ccc(C(=O)O)cc1C.
What is the InChIKey of ethane;4-ethyl-3-methylbenzoic acid?
The InChIKey is MKUINZBPLZIIDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.3C2H6/c1-3-8-4-5-9(10(11)12)6-7(8)2;3*1-2/h4-6H,3H2,1-2H3,(H,11,12);3*1-2H3.
What are the key properties of ethane;4-ethyl-3-methylbenzoic acid?
ethane;4-ethyl-3-methylbenzoic acid has a molecular weight of 254.41 g/mol, XLogP of 5.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-3-methylbenzoic acid is sourced from PubChem (CID 144686494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).