C12H17NO — CID 150723672
4-ethyl-N,N,3-trimethylbenzamide (PubChem CID 150723672) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-ethyl-N,N,3-trimethylbenzamide.
| Compound Name | 4-ethyl-N,N,3-trimethylbenzamide |
|---|---|
| PubChem CID | 150723672 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-ethyl-N,N,3-trimethylbenzamide |
| SMILES | CCc1ccc(C(=O)N(C)C)cc1C |
| InChI | InChI=1S/C12H17NO/c1-5-10-6-7-11(8-9(10)2)12(14)13(3)4/h6-8H,5H2,1-4H3 |
| InChIKey | JQJKCJJUVMRLLB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |