C15H28 — CID 158451617
1,4-diethyl-2-methylbenzene;ethane (PubChem CID 158451617) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 1,4-diethyl-2-methylbenzene;ethane.
| Compound Name | 1,4-diethyl-2-methylbenzene;ethane |
|---|---|
| PubChem CID | 158451617 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 1,4-diethyl-2-methylbenzene;ethane |
| SMILES | CC.CC.CCc1ccc(CC)c(C)c1 |
| InChI | InChI=1S/C11H16.2C2H6/c1-4-10-6-7-11(5-2)9(3)8-10;2*1-2/h6-8H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | HEBIYBKAHCZJHV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |