C11H16O — CID 21414896
(2,4-diethylphenyl)methanol (PubChem CID 21414896) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (2,4-diethylphenyl)methanol.
| Compound Name | (2,4-diethylphenyl)methanol |
|---|---|
| PubChem CID | 21414896 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (2,4-diethylphenyl)methanol |
| SMILES | CCc1ccc(CO)c(CC)c1 |
| InChI | InChI=1S/C11H16O/c1-3-9-5-6-11(8-12)10(4-2)7-9/h5-7,12H,3-4,8H2,1-2H3 |
| InChIKey | DVMOGHSUSIIMEP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |