C11H16ClNS — CID 134459151
[(2,4-diethylphenyl)methylamino] thiohypochlorite (PubChem CID 134459151) has the molecular formula C11H16ClNS and a molecular weight of 229.78 g/mol. Its IUPAC name is [(2,4-diethylphenyl)methylamino] thiohypochlorite.
| Compound Name | [(2,4-diethylphenyl)methylamino] thiohypochlorite |
|---|---|
| PubChem CID | 134459151 |
| Molecular Formula | C11H16ClNS |
| Molecular Weight | 229.78 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | [(2,4-diethylphenyl)methylamino] thiohypochlorite |
| SMILES | CCc1ccc(CNSCl)c(CC)c1 |
| InChI | InChI=1S/C11H16ClNS/c1-3-9-5-6-11(8-13-14-12)10(4-2)7-9/h5-7,13H,3-4,8H2,1-2H3 |
| InChIKey | OINSUOWYVDKNJZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|