About N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine
N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine (PubChem CID 154954779) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine.
Molecular Properties
| Compound Name | N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine |
| PubChem CID | 154954779 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1ccc(CC)cc1CC |
| InChI | InChI=1S/C14H19N/c1-4-9-15-11-14-8-7-12(5-2)10-13(14)6-3/h1,7-8,10,15H,5-6,9,11H2,2-3H3 |
| InChIKey | ZRHIMJFEILSIKG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine?
The IUPAC name of N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine (CID 154954779) is N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine.
What is the SMILES notation for N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine?
The canonical SMILES for N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine is C#CCNCc1ccc(CC)cc1CC.
What is the InChIKey of N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine?
The InChIKey is ZRHIMJFEILSIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-4-9-15-11-14-8-7-12(5-2)10-13(14)6-3/h1,7-8,10,15H,5-6,9,11H2,2-3H3.
What are the key properties of N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine?
N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine has a molecular weight of 201.31 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-diethylphenyl)methyl]prop-2-yn-1-amine is sourced from PubChem (CID 154954779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).