C10H9Br2N — CID 115692967
N-[(3,4-dibromophenyl)methyl]prop-2-yn-1-amine (PubChem CID 115692967) has the molecular formula C10H9Br2N and a molecular weight of 303.00 g/mol. Its IUPAC name is N-[(3,4-dibromophenyl)methyl]prop-2-yn-1-amine.
| Compound Name | N-[(3,4-dibromophenyl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 115692967 |
| Molecular Formula | C10H9Br2N |
| Molecular Weight | 303.00 g/mol |
| Exact Mass | 300.91 |
| IUPAC Name | N-[(3,4-dibromophenyl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C10H9Br2N/c1-2-5-13-7-8-3-4-9(11)10(12)6-8/h1,3-4,6,13H,5,7H2 |
| InChIKey | UTDICGKWJUFACC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.00 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|