C11H12BrNO — CID 65323575
N-[(2-bromo-5-methoxyphenyl)methyl]prop-2-yn-1-amine (PubChem CID 65323575) has the molecular formula C11H12BrNO and a molecular weight of 254.13 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxyphenyl)methyl]prop-2-yn-1-amine.
| Compound Name | N-[(2-bromo-5-methoxyphenyl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 65323575 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | N-[(2-bromo-5-methoxyphenyl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1cc(OC)ccc1Br |
| InChI | InChI=1S/C11H12BrNO/c1-3-6-13-8-9-7-10(14-2)4-5-11(9)12/h1,4-5,7,13H,6,8H2,2H3 |
| InChIKey | AWVNCWBXRVUACE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|