C13H19BrN2O2 — CID 65323932
3-[(2-bromo-5-methoxyphenyl)methylamino]-N,N-dimethylpropanamide (PubChem CID 65323932) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 3-[(2-bromo-5-methoxyphenyl)methylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(2-bromo-5-methoxyphenyl)methylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 65323932 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 3-[(2-bromo-5-methoxyphenyl)methylamino]-N,N-dimethylpropanamide |
| SMILES | COc1ccc(Br)c(CNCCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H19BrN2O2/c1-16(2)13(17)6-7-15-9-10-8-11(18-3)4-5-12(10)14/h4-5,8,15H,6-7,9H2,1-3H3 |
| InChIKey | KOSRTOZBDBQMEG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|