C12H14BrNO — CID 65323558
N-[(2-bromo-5-methoxyphenyl)methyl]but-3-yn-1-amine (PubChem CID 65323558) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxyphenyl)methyl]but-3-yn-1-amine.
| Compound Name | N-[(2-bromo-5-methoxyphenyl)methyl]but-3-yn-1-amine |
|---|---|
| PubChem CID | 65323558 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-[(2-bromo-5-methoxyphenyl)methyl]but-3-yn-1-amine |
| SMILES | C#CCCNCc1cc(OC)ccc1Br |
| InChI | InChI=1S/C12H14BrNO/c1-3-4-7-14-9-10-8-11(15-2)5-6-12(10)13/h1,5-6,8,14H,4,7,9H2,2H3 |
| InChIKey | RVDHIRMGGRVFMN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|