C15H21BrN2O2 — CID 115751534
3-[(2-bromo-5-methoxyphenyl)methylamino]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 115751534) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 3-[(2-bromo-5-methoxyphenyl)methylamino]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-[(2-bromo-5-methoxyphenyl)methylamino]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 115751534 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 3-[(2-bromo-5-methoxyphenyl)methylamino]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | COc1ccc(Br)c(CNCCC(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-20-13-4-5-14(16)12(10-13)11-17-7-6-15(19)18-8-2-3-9-18/h4-5,10,17H,2-3,6-9,11H2,1H3 |
| InChIKey | BQNBAOANNCAUFF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|