C12H17NO4 — CID 43112090
3-[(2,5-dimethoxyphenyl)methylamino]propanoic acid (PubChem CID 43112090) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)methylamino]propanoic acid.
| Compound Name | 3-[(2,5-dimethoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 43112090 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-[(2,5-dimethoxyphenyl)methylamino]propanoic acid |
| SMILES | COc1ccc(OC)c(CNCCC(=O)O)c1 |
| InChI | InChI=1S/C12H17NO4/c1-16-10-3-4-11(17-2)9(7-10)8-13-6-5-12(14)15/h3-4,7,13H,5-6,8H2,1-2H3,(H,14,15) |
| InChIKey | LCBPMDQYIDQYLR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|