C16H24FNO3 — CID 65287183
6-[(5-fluoro-2-methoxyphenyl)methylamino]-4,4-dimethylhexanoic acid (PubChem CID 65287183) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is 6-[(5-fluoro-2-methoxyphenyl)methylamino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(5-fluoro-2-methoxyphenyl)methylamino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65287183 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 6-[(5-fluoro-2-methoxyphenyl)methylamino]-4,4-dimethylhexanoic acid |
| SMILES | COc1ccc(F)cc1CNCCC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C16H24FNO3/c1-16(2,7-6-15(19)20)8-9-18-11-12-10-13(17)4-5-14(12)21-3/h4-5,10,18H,6-9,11H2,1-3H3,(H,19,20) |
| InChIKey | XKROPEMPPWEJCH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|