C15H21BrFNO2 — CID 65287832
6-[(5-bromo-2-fluorophenyl)methylamino]-4,4-dimethylhexanoic acid (PubChem CID 65287832) has the molecular formula C15H21BrFNO2 and a molecular weight of 346.24 g/mol. Its IUPAC name is 6-[(5-bromo-2-fluorophenyl)methylamino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(5-bromo-2-fluorophenyl)methylamino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65287832 |
| Molecular Formula | C15H21BrFNO2 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 6-[(5-bromo-2-fluorophenyl)methylamino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNCc1cc(Br)ccc1F)CCC(=O)O |
| InChI | InChI=1S/C15H21BrFNO2/c1-15(2,6-5-14(19)20)7-8-18-10-11-9-12(16)3-4-13(11)17/h3-4,9,18H,5-8,10H2,1-2H3,(H,19,20) |
| InChIKey | HKVGPVIETXMZOG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|