C12H15BrFNO3 — CID 104644127
methyl 3-[(5-bromo-2-fluorophenyl)methylamino]-2-hydroxy-2-methylpropanoate (PubChem CID 104644127) has the molecular formula C12H15BrFNO3 and a molecular weight of 320.16 g/mol. Its IUPAC name is methyl 3-[(5-bromo-2-fluorophenyl)methylamino]-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-[(5-bromo-2-fluorophenyl)methylamino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 104644127 |
| Molecular Formula | C12H15BrFNO3 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | methyl 3-[(5-bromo-2-fluorophenyl)methylamino]-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNCc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H15BrFNO3/c1-12(17,11(16)18-2)7-15-6-8-5-9(13)3-4-10(8)14/h3-5,15,17H,6-7H2,1-2H3 |
| InChIKey | LENSAZFNMMUBLW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |