C12H13BrF3NO4 — CID 103193251
methyl 3-[4-bromo-2-(trifluoromethoxy)anilino]-2-hydroxy-2-methylpropanoate (PubChem CID 103193251) has the molecular formula C12H13BrF3NO4 and a molecular weight of 372.14 g/mol. Its IUPAC name is methyl 3-[4-bromo-2-(trifluoromethoxy)anilino]-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-[4-bromo-2-(trifluoromethoxy)anilino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 103193251 |
| Molecular Formula | C12H13BrF3NO4 |
| Molecular Weight | 372.14 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | methyl 3-[4-bromo-2-(trifluoromethoxy)anilino]-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNc1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C12H13BrF3NO4/c1-11(19,10(18)20-2)6-17-8-4-3-7(13)5-9(8)21-12(14,15)16/h3-5,17,19H,6H2,1-2H3 |
| InChIKey | XMPGDILLFQBAIK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.14 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |