C11H12BrF3N2O2 — CID 103193272
3-[4-bromo-2-(trifluoromethoxy)anilino]-N-methylpropanamide (PubChem CID 103193272) has the molecular formula C11H12BrF3N2O2 and a molecular weight of 341.13 g/mol. Its IUPAC name is 3-[4-bromo-2-(trifluoromethoxy)anilino]-N-methylpropanamide.
| Compound Name | 3-[4-bromo-2-(trifluoromethoxy)anilino]-N-methylpropanamide |
|---|---|
| PubChem CID | 103193272 |
| Molecular Formula | C11H12BrF3N2O2 |
| Molecular Weight | 341.13 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 3-[4-bromo-2-(trifluoromethoxy)anilino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNc1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H12BrF3N2O2/c1-16-10(18)4-5-17-8-3-2-7(12)6-9(8)19-11(13,14)15/h2-3,6,17H,4-5H2,1H3,(H,16,18) |
| InChIKey | GNCLVXGELQRBHR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |