6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid

C17H27NO2 — CID 65287724

IUPAC6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid
SMILESCCc1ccc(CNCCC(C)(C)CCC(=O)O)cc1
InChIInChI=1S/C17H27NO2/c1-4-14-5-7-15(8-6-14)13-18-12-11-17(2,3)10-9-16(19)20/h5-8,18H,4,9-13H2,1-3H3,(H,19,20)
InChIKeyWRONRGNUCYTVCP-UHFFFAOYSA-N
MW277.41 g/mol
LogP3.62
Rot. Bonds9

About 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid

6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid (PubChem CID 65287724) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid.

Molecular Properties

Compound Name6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid
PubChem CID65287724
Molecular FormulaC17H27NO2
Molecular Weight277.41 g/mol
Exact Mass277.20
IUPAC Name6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid
SMILESCCc1ccc(CNCCC(C)(C)CCC(=O)O)cc1
InChIInChI=1S/C17H27NO2/c1-4-14-5-7-15(8-6-14)13-18-12-11-17(2,3)10-9-16(19)20/h5-8,18H,4,9-13H2,1-3H3,(H,19,20)
InChIKeyWRONRGNUCYTVCP-UHFFFAOYSA-N
XLogP3.62
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.41
LogP ≤ 53.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid?
The IUPAC name of 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid (CID 65287724) is 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid.
What is the SMILES notation for 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid?
The canonical SMILES for 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid is CCc1ccc(CNCCC(C)(C)CCC(=O)O)cc1.
What is the InChIKey of 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid?
The InChIKey is WRONRGNUCYTVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-4-14-5-7-15(8-6-14)13-18-12-11-17(2,3)10-9-16(19)20/h5-8,18H,4,9-13H2,1-3H3,(H,19,20).
What are the key properties of 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid?
6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid has a molecular weight of 277.41 g/mol, XLogP of 3.62, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-ethylphenyl)methylamino]-4,4-dimethylhexanoic acid is sourced from PubChem (CID 65287724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).