C12H20N2O3 — CID 65287088
4,4-dimethyl-6-(1,2-oxazol-5-ylmethylamino)hexanoic acid (PubChem CID 65287088) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4,4-dimethyl-6-(1,2-oxazol-5-ylmethylamino)hexanoic acid.
| Compound Name | 4,4-dimethyl-6-(1,2-oxazol-5-ylmethylamino)hexanoic acid |
|---|---|
| PubChem CID | 65287088 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4,4-dimethyl-6-(1,2-oxazol-5-ylmethylamino)hexanoic acid |
| SMILES | CC(C)(CCNCc1ccno1)CCC(=O)O |
| InChI | InChI=1S/C12H20N2O3/c1-12(2,5-3-11(15)16)6-8-13-9-10-4-7-14-17-10/h4,7,13H,3,5-6,8-9H2,1-2H3,(H,15,16) |
| InChIKey | GSANTESCGMVCMC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|