2-(1,2-oxazol-5-ylmethylamino)acetic acid

C6H8N2O3 — CID 43466227

IUPAC2-(1,2-oxazol-5-ylmethylamino)acetic acid
SMILESO=C(O)CNCc1ccno1
InChIInChI=1S/C6H8N2O3/c9-6(10)4-7-3-5-1-2-8-11-5/h1-2,7H,3-4H2,(H,9,10)
InChIKeyQPPLSGRAWLTKMX-UHFFFAOYSA-N
MW156.14 g/mol
LogP-0.15
Rot. Bonds4

About 2-(1,2-oxazol-5-ylmethylamino)acetic acid

2-(1,2-oxazol-5-ylmethylamino)acetic acid (PubChem CID 43466227) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-(1,2-oxazol-5-ylmethylamino)acetic acid.

Molecular Properties

Compound Name2-(1,2-oxazol-5-ylmethylamino)acetic acid
PubChem CID43466227
Molecular FormulaC6H8N2O3
Molecular Weight156.14 g/mol
Exact Mass156.05
IUPAC Name2-(1,2-oxazol-5-ylmethylamino)acetic acid
SMILESO=C(O)CNCc1ccno1
InChIInChI=1S/C6H8N2O3/c9-6(10)4-7-3-5-1-2-8-11-5/h1-2,7H,3-4H2,(H,9,10)
InChIKeyQPPLSGRAWLTKMX-UHFFFAOYSA-N
XLogP-0.15
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 5-0.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(1,2-oxazol-5-ylmethylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-oxazol-5-ylmethylamino)acetic acid?
The IUPAC name of 2-(1,2-oxazol-5-ylmethylamino)acetic acid (CID 43466227) is 2-(1,2-oxazol-5-ylmethylamino)acetic acid.
What is the SMILES notation for 2-(1,2-oxazol-5-ylmethylamino)acetic acid?
The canonical SMILES for 2-(1,2-oxazol-5-ylmethylamino)acetic acid is O=C(O)CNCc1ccno1.
What is the InChIKey of 2-(1,2-oxazol-5-ylmethylamino)acetic acid?
The InChIKey is QPPLSGRAWLTKMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c9-6(10)4-7-3-5-1-2-8-11-5/h1-2,7H,3-4H2,(H,9,10).
What are the key properties of 2-(1,2-oxazol-5-ylmethylamino)acetic acid?
2-(1,2-oxazol-5-ylmethylamino)acetic acid has a molecular weight of 156.14 g/mol, XLogP of -0.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-oxazol-5-ylmethylamino)acetic acid is sourced from PubChem (CID 43466227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).