C8H10N4O2 — CID 106417912
N-(cyanomethyl)-2-(1,2-oxazol-5-ylmethylamino)acetamide (PubChem CID 106417912) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(1,2-oxazol-5-ylmethylamino)acetamide.
| Compound Name | N-(cyanomethyl)-2-(1,2-oxazol-5-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 106417912 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | N-(cyanomethyl)-2-(1,2-oxazol-5-ylmethylamino)acetamide |
| SMILES | N#CCNC(=O)CNCc1ccno1 |
| InChI | InChI=1S/C8H10N4O2/c9-2-4-11-8(13)6-10-5-7-1-3-12-14-7/h1,3,10H,4-6H2,(H,11,13) |
| InChIKey | CDUDPVMMBQQTAK-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|