C10H14N4O2 — CID 106371540
N-(cyanomethyl)-2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]acetamide (PubChem CID 106371540) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]acetamide.
| Compound Name | N-(cyanomethyl)-2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 106371540 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | N-(cyanomethyl)-2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]acetamide |
| SMILES | CCc1cnc(CNCC(=O)NCC#N)o1 |
| InChI | InChI=1S/C10H14N4O2/c1-2-8-5-14-10(16-8)7-12-6-9(15)13-4-3-11/h5,12H,2,4,6-7H2,1H3,(H,13,15) |
| InChIKey | LEKWEZZRDPVKPG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|