C10H15BrN2O3 — CID 106373494
methyl 2-bromo-3-[(5-ethyl-1,3-oxazol-2-yl)methylamino]propanoate (PubChem CID 106373494) has the molecular formula C10H15BrN2O3 and a molecular weight of 291.15 g/mol. Its IUPAC name is methyl 2-bromo-3-[(5-ethyl-1,3-oxazol-2-yl)methylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[(5-ethyl-1,3-oxazol-2-yl)methylamino]propanoate |
|---|---|
| PubChem CID | 106373494 |
| Molecular Formula | C10H15BrN2O3 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | methyl 2-bromo-3-[(5-ethyl-1,3-oxazol-2-yl)methylamino]propanoate |
| SMILES | CCc1cnc(CNCC(Br)C(=O)OC)o1 |
| InChI | InChI=1S/C10H15BrN2O3/c1-3-7-4-13-9(16-7)6-12-5-8(11)10(14)15-2/h4,8,12H,3,5-6H2,1-2H3 |
| InChIKey | NLHZGKCHWFFJMV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|