C9H16N2O2 — CID 106371562
(2R)-1-[(5-ethyl-1,3-oxazol-2-yl)methylamino]propan-2-ol (PubChem CID 106371562) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (2R)-1-[(5-ethyl-1,3-oxazol-2-yl)methylamino]propan-2-ol.
| Compound Name | (2R)-1-[(5-ethyl-1,3-oxazol-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 106371562 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (2R)-1-[(5-ethyl-1,3-oxazol-2-yl)methylamino]propan-2-ol |
| SMILES | CCc1cnc(CNC[C@@H](C)O)o1 |
| InChI | InChI=1S/C9H16N2O2/c1-3-8-5-11-9(13-8)6-10-4-7(2)12/h5,7,10,12H,3-4,6H2,1-2H3/t7-/m1/s1 |
| InChIKey | PJWPNCXLNXSZOL-SSDOTTSWSA-N |
| XLogP | 0.71 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |