C10H17N3O2 — CID 106371196
2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]butanamide (PubChem CID 106371196) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]butanamide.
| Compound Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 106371196 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]butanamide |
| SMILES | CCc1cnc(CNC(CC)C(N)=O)o1 |
| InChI | InChI=1S/C10H17N3O2/c1-3-7-5-13-9(15-7)6-12-8(4-2)10(11)14/h5,8,12H,3-4,6H2,1-2H3,(H2,11,14) |
| InChIKey | JXOPEAQQMMOKJS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |