C10H16N4O3 — CID 106370829
2-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]butanediamide (PubChem CID 106370829) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]butanediamide.
| Compound Name | 2-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]butanediamide |
|---|---|
| PubChem CID | 106370829 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]butanediamide |
| SMILES | CCc1cnc(CNC(=O)C(N)CC(N)=O)o1 |
| InChI | InChI=1S/C10H16N4O3/c1-2-6-4-13-9(17-6)5-14-10(16)7(11)3-8(12)15/h4,7H,2-3,5,11H2,1H3,(H2,12,15)(H,14,16) |
| InChIKey | PLYCTQFACQENOQ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |