C9H15N3O2 — CID 103797047
2-amino-N-[(5-methyl-1,3-oxazol-2-yl)methyl]butanamide (PubChem CID 103797047) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-amino-N-[(5-methyl-1,3-oxazol-2-yl)methyl]butanamide.
| Compound Name | 2-amino-N-[(5-methyl-1,3-oxazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 103797047 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-amino-N-[(5-methyl-1,3-oxazol-2-yl)methyl]butanamide |
| SMILES | CCC(N)C(=O)NCc1ncc(C)o1 |
| InChI | InChI=1S/C9H15N3O2/c1-3-7(10)9(13)12-5-8-11-4-6(2)14-8/h4,7H,3,5,10H2,1-2H3,(H,12,13) |
| InChIKey | XXPFYUKGEGSFKS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |