C8H12N2O2S — CID 106377758
N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-sulfanylpropanamide (PubChem CID 106377758) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-sulfanylpropanamide.
| Compound Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 106377758 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-sulfanylpropanamide |
| SMILES | Cc1cnc(CNC(=O)C(C)S)o1 |
| InChI | InChI=1S/C8H12N2O2S/c1-5-3-9-7(12-5)4-10-8(11)6(2)13/h3,6,13H,4H2,1-2H3,(H,10,11) |
| InChIKey | FXIOKMTYTNAXRD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|