C14H25N3O2 — CID 106371015
6-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylheptanamide (PubChem CID 106371015) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 6-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylheptanamide.
| Compound Name | 6-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylheptanamide |
|---|---|
| PubChem CID | 106371015 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 6-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylheptanamide |
| SMILES | CCc1cnc(CNC(=O)C(C)CCCC(C)N)o1 |
| InChI | InChI=1S/C14H25N3O2/c1-4-12-8-16-13(19-12)9-17-14(18)10(2)6-5-7-11(3)15/h8,10-11H,4-7,9,15H2,1-3H3,(H,17,18) |
| InChIKey | KAFYHXTVIPYBNJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |