C16H21N3O2 — CID 106370852
4-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-phenylbutanamide (PubChem CID 106370852) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-phenylbutanamide.
| Compound Name | 4-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 106370852 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-phenylbutanamide |
| SMILES | CCc1cnc(CNC(=O)CCC(N)c2ccccc2)o1 |
| InChI | InChI=1S/C16H21N3O2/c1-2-13-10-19-16(21-13)11-18-15(20)9-8-14(17)12-6-4-3-5-7-12/h3-7,10,14H,2,8-9,11,17H2,1H3,(H,18,20) |
| InChIKey | IUIHLXKABQJZRK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |