C12H20N2O3 — CID 106371541
ethyl 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]butanoate (PubChem CID 106371541) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethyl 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]butanoate.
| Compound Name | ethyl 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 106371541 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | ethyl 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]butanoate |
| SMILES | CCOC(=O)C(CC)NCc1ncc(CC)o1 |
| InChI | InChI=1S/C12H20N2O3/c1-4-9-7-14-11(17-9)8-13-10(5-2)12(15)16-6-3/h7,10,13H,4-6,8H2,1-3H3 |
| InChIKey | YQUDNVZMORZDGB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |