C11H17N3O4 — CID 106374246
2-[(5-ethyl-1,3-oxazol-2-yl)methylcarbamoylamino]butanoic acid (PubChem CID 106374246) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3-oxazol-2-yl)methylcarbamoylamino]butanoic acid.
| Compound Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 106374246 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methylcarbamoylamino]butanoic acid |
| SMILES | CCc1cnc(CNC(=O)NC(CC)C(=O)O)o1 |
| InChI | InChI=1S/C11H17N3O4/c1-3-7-5-12-9(18-7)6-13-11(17)14-8(4-2)10(15)16/h5,8H,3-4,6H2,1-2H3,(H,15,16)(H2,13,14,17) |
| InChIKey | VXRFBEKDOQIAFT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |