C17H21NO3 — CID 61239059
4-[2-[(2,5-dimethoxyphenyl)methylamino]ethyl]phenol (PubChem CID 61239059) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[2-[(2,5-dimethoxyphenyl)methylamino]ethyl]phenol.
| Compound Name | 4-[2-[(2,5-dimethoxyphenyl)methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 61239059 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[2-[(2,5-dimethoxyphenyl)methylamino]ethyl]phenol |
| SMILES | COc1ccc(OC)c(CNCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C17H21NO3/c1-20-16-7-8-17(21-2)14(11-16)12-18-10-9-13-3-5-15(19)6-4-13/h3-8,11,18-19H,9-10,12H2,1-2H3 |
| InChIKey | CHORNCYLIYOTAW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|