C23H25NO3 — CID 45488367
4-(2,5-dimethoxyphenyl)-2-[(2-phenylethylamino)methyl]phenol (PubChem CID 45488367) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-2-[(2-phenylethylamino)methyl]phenol.
| Compound Name | 4-(2,5-dimethoxyphenyl)-2-[(2-phenylethylamino)methyl]phenol |
|---|---|
| PubChem CID | 45488367 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-2-[(2-phenylethylamino)methyl]phenol |
| SMILES | COc1ccc(OC)c(-c2ccc(O)c(CNCCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H25NO3/c1-26-20-9-11-23(27-2)21(15-20)18-8-10-22(25)19(14-18)16-24-13-12-17-6-4-3-5-7-17/h3-11,14-15,24-25H,12-13,16H2,1-2H3 |
| InChIKey | ARLXUIYUADJNAA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|