C23H31NO3 — CID 45488585
2-[(cyclooctylamino)methyl]-4-(2,5-dimethoxyphenyl)phenol (PubChem CID 45488585) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[(cyclooctylamino)methyl]-4-(2,5-dimethoxyphenyl)phenol.
| Compound Name | 2-[(cyclooctylamino)methyl]-4-(2,5-dimethoxyphenyl)phenol |
|---|---|
| PubChem CID | 45488585 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-[(cyclooctylamino)methyl]-4-(2,5-dimethoxyphenyl)phenol |
| SMILES | COc1ccc(OC)c(-c2ccc(O)c(CNC3CCCCCCC3)c2)c1 |
| InChI | InChI=1S/C23H31NO3/c1-26-20-11-13-23(27-2)21(15-20)17-10-12-22(25)18(14-17)16-24-19-8-6-4-3-5-7-9-19/h10-15,19,24-25H,3-9,16H2,1-2H3 |
| InChIKey | YIQFSZTVSRZPAY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|