C18H21NO4 — CID 45219852
4-methoxy-2-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]phenol (PubChem CID 45219852) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-methoxy-2-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]phenol.
| Compound Name | 4-methoxy-2-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 45219852 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-methoxy-2-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]phenol |
| SMILES | COc1ccc(O)c(CNC2COc3c(cccc3OC)C2)c1 |
| InChI | InChI=1S/C18H21NO4/c1-21-15-6-7-16(20)13(9-15)10-19-14-8-12-4-3-5-17(22-2)18(12)23-11-14/h3-7,9,14,19-20H,8,10-11H2,1-2H3 |
| InChIKey | FVNJIIAPJOLZQA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|