About 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one
3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one (PubChem CID 131900980) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one.
Molecular Properties
| Compound Name | 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one |
| PubChem CID | 131900980 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one |
| SMILES | COc1cccc2c1OCC(NCc1cc3ccccc3n(C)c1=O)C2 |
| InChI | InChI=1S/C21H22N2O3/c1-23-18-8-4-3-6-14(18)10-16(21(23)24)12-22-17-11-15-7-5-9-19(25-2)20(15)26-13-17/h3-10,17,22H,11-13H2,1-2H3 |
| InChIKey | XIOHZKHNGWXRLT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one?
The IUPAC name of 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one (CID 131900980) is 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one.
What is the SMILES notation for 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one?
The canonical SMILES for 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one is COc1cccc2c1OCC(NCc1cc3ccccc3n(C)c1=O)C2.
What is the InChIKey of 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one?
The InChIKey is XIOHZKHNGWXRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-23-18-8-4-3-6-14(18)10-16(21(23)24)12-22-17-11-15-7-5-9-19(25-2)20(15)26-13-17/h3-10,17,22H,11-13H2,1-2H3.
What are the key properties of 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one?
3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one has a molecular weight of 350.42 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)amino]methyl]-1-methylquinolin-2-one is sourced from PubChem (CID 131900980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).