C14H21NO2 — CID 171535788
N-[(2,4-dimethoxyphenyl)methyl]prop-2-yn-1-amine;ethane (PubChem CID 171535788) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]prop-2-yn-1-amine;ethane.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]prop-2-yn-1-amine;ethane |
|---|---|
| PubChem CID | 171535788 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]prop-2-yn-1-amine;ethane |
| SMILES | C#CCNCc1ccc(OC)cc1OC.CC |
| InChI | InChI=1S/C12H15NO2.C2H6/c1-4-7-13-9-10-5-6-11(14-2)8-12(10)15-3;1-2/h1,5-6,8,13H,7,9H2,2-3H3;1-2H3 |
| InChIKey | UFHUIFQGHATFSE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|