C11H12ClN — CID 106815995
N-[(3-chloro-4-methylphenyl)methyl]prop-2-yn-1-amine (PubChem CID 106815995) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is N-[(3-chloro-4-methylphenyl)methyl]prop-2-yn-1-amine.
| Compound Name | N-[(3-chloro-4-methylphenyl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 106815995 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-[(3-chloro-4-methylphenyl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClN/c1-3-6-13-8-10-5-4-9(2)11(12)7-10/h1,4-5,7,13H,6,8H2,2H3 |
| InChIKey | JLBDIHRAHXDQMR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|