C27H36O2 — CID 158546395
2-(3,4-diethylphenyl)ethyl 4-(4-ethylcyclohexyl)benzoate (PubChem CID 158546395) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-(3,4-diethylphenyl)ethyl 4-(4-ethylcyclohexyl)benzoate.
| Compound Name | 2-(3,4-diethylphenyl)ethyl 4-(4-ethylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 158546395 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 2-(3,4-diethylphenyl)ethyl 4-(4-ethylcyclohexyl)benzoate |
| SMILES | CCc1ccc(CCOC(=O)c2ccc(C3CCC(CC)CC3)cc2)cc1CC |
| InChI | InChI=1S/C27H36O2/c1-4-20-7-11-24(12-8-20)25-13-15-26(16-14-25)27(28)29-18-17-21-9-10-22(5-2)23(6-3)19-21/h9-10,13-16,19-20,24H,4-8,11-12,17-18H2,1-3H3 |
| InChIKey | NVWDVAMFQAUPBD-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |