C28H32O8 — CID 54349547
4-O-[2-[4-[(4-ethylcyclohexyl)methoxycarbonyl]benzoyl]oxyethyl] 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 54349547) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is 4-O-[2-[4-[(4-ethylcyclohexyl)methoxycarbonyl]benzoyl]oxyethyl] 1-O-methyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-[4-[(4-ethylcyclohexyl)methoxycarbonyl]benzoyl]oxyethyl] 1-O-methyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 54349547 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 4-O-[2-[4-[(4-ethylcyclohexyl)methoxycarbonyl]benzoyl]oxyethyl] 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | CCC1CCC(COC(=O)c2ccc(C(=O)OCCOC(=O)c3ccc(C(=O)OC)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H32O8/c1-3-19-4-6-20(7-5-19)18-36-28(32)24-14-12-23(13-15-24)27(31)35-17-16-34-26(30)22-10-8-21(9-11-22)25(29)33-2/h8-15,19-20H,3-7,16-18H2,1-2H3 |
| InChIKey | UETJHANJCAVCFL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|