C20H28O4 — CID 144946673
[4-(methoxymethyl)cyclohexyl]methyl 4-(2-methylpropanoyl)benzoate (PubChem CID 144946673) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [4-(methoxymethyl)cyclohexyl]methyl 4-(2-methylpropanoyl)benzoate.
| Compound Name | [4-(methoxymethyl)cyclohexyl]methyl 4-(2-methylpropanoyl)benzoate |
|---|---|
| PubChem CID | 144946673 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [4-(methoxymethyl)cyclohexyl]methyl 4-(2-methylpropanoyl)benzoate |
| SMILES | COCC1CCC(COC(=O)c2ccc(C(=O)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H28O4/c1-14(2)19(21)17-8-10-18(11-9-17)20(22)24-13-16-6-4-15(5-7-16)12-23-3/h8-11,14-16H,4-7,12-13H2,1-3H3 |
| InChIKey | QPXDSSQOIGIFAQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |