C24H34O6 — CID 159543394
[4-(hydroxymethyl)cyclohexyl]methyl 4-[2-hydroxy-2-(4-methoxycyclohexyl)acetyl]benzoate (PubChem CID 159543394) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [4-(hydroxymethyl)cyclohexyl]methyl 4-[2-hydroxy-2-(4-methoxycyclohexyl)acetyl]benzoate.
| Compound Name | [4-(hydroxymethyl)cyclohexyl]methyl 4-[2-hydroxy-2-(4-methoxycyclohexyl)acetyl]benzoate |
|---|---|
| PubChem CID | 159543394 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [4-(hydroxymethyl)cyclohexyl]methyl 4-[2-hydroxy-2-(4-methoxycyclohexyl)acetyl]benzoate |
| SMILES | COC1CCC(C(O)C(=O)c2ccc(C(=O)OCC3CCC(CO)CC3)cc2)CC1 |
| InChI | InChI=1S/C24H34O6/c1-29-21-12-10-19(11-13-21)23(27)22(26)18-6-8-20(9-7-18)24(28)30-15-17-4-2-16(14-25)3-5-17/h6-9,16-17,19,21,23,25,27H,2-5,10-15H2,1H3 |
| InChIKey | NPKLXSDHWLGHSP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |