C28H36O6 — CID 54489538
bis[[4-(hydroxymethyl)cyclohexyl]methyl] naphthalene-2,6-dicarboxylate (PubChem CID 54489538) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is bis[[4-(hydroxymethyl)cyclohexyl]methyl] naphthalene-2,6-dicarboxylate.
| Compound Name | bis[[4-(hydroxymethyl)cyclohexyl]methyl] naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 54489538 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | bis[[4-(hydroxymethyl)cyclohexyl]methyl] naphthalene-2,6-dicarboxylate |
| SMILES | O=C(OCC1CCC(CO)CC1)c1ccc2cc(C(=O)OCC3CCC(CO)CC3)ccc2c1 |
| InChI | InChI=1S/C28H36O6/c29-15-19-1-5-21(6-2-19)17-33-27(31)25-11-9-24-14-26(12-10-23(24)13-25)28(32)34-18-22-7-3-20(16-30)4-8-22/h9-14,19-22,29-30H,1-8,15-18H2 |
| InChIKey | XUTBUNAHYVIROE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |