C17H24N4S — CID 134569001
4-N-butyl-5-[(4-ethylphenyl)methylsulfanyl]pyrimidine-2,4-diamine (PubChem CID 134569001) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 4-N-butyl-5-[(4-ethylphenyl)methylsulfanyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[(4-ethylphenyl)methylsulfanyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134569001 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-N-butyl-5-[(4-ethylphenyl)methylsulfanyl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1SCc1ccc(CC)cc1 |
| InChI | InChI=1S/C17H24N4S/c1-3-5-10-19-16-15(11-20-17(18)21-16)22-12-14-8-6-13(4-2)7-9-14/h6-9,11H,3-5,10,12H2,1-2H3,(H3,18,19,20,21) |
| InChIKey | CVECVBVYOMHKJT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|