C12H21N5 — CID 135252889
5-N-but-3-enyl-4-N-butylpyrimidine-2,4,5-triamine (PubChem CID 135252889) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-N-but-3-enyl-4-N-butylpyrimidine-2,4,5-triamine.
| Compound Name | 5-N-but-3-enyl-4-N-butylpyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 135252889 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 5-N-but-3-enyl-4-N-butylpyrimidine-2,4,5-triamine |
| SMILES | C=CCCNc1cnc(N)nc1NCCCC |
| InChI | InChI=1S/C12H21N5/c1-3-5-7-14-10-9-16-12(13)17-11(10)15-8-6-4-2/h3,9,14H,1,4-8H2,2H3,(H3,13,15,16,17) |
| InChIKey | BOPQRLRMMFMXIG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|